ChemNet > CAS > 175278-50-9 3-{4-[(4-methylphenyl)thio]-3-nitrophenyl}acrylic acid
175278-50-9 3-{4-[(4-methylphenyl)thio]-3-nitrophenyl}acrylic acid
Nazwa produktu: |
3-{4-[(4-methylphenyl)thio]-3-nitrophenyl}acrylic acid |
Synonimy |
3-[4-[(4-Methylphenyl)thio]-3-nitrophenyl]acrylic acid; (2E)-3-{4-[(4-methylphenyl)sulfanyl]-3-nitrophenyl}prop-2-enoic acid |
MF |
C16H13NO4S |
Masie cząsteczkowej |
315.3437 |
InChI |
InChI=1/C16H13NO4S/c1-11-2-6-13(7-3-11)22-15-8-4-12(5-9-16(18)19)10-14(15)17(20)21/h2-10H,1H3,(H,18,19)/b9-5+ |
Nr CAS |
175278-50-9 |
Struktury molekularnej |
|
Gęstość |
1.38g/cm3 |
Temperatura topnienia |
217℃ |
Temperatura wrzenia |
505°C at 760 mmHg |
Współczynnik załamania |
1.673 |
Temperatura zapłonu |
259.2°C |
Symbole zagrożenia |
Xi:Irritant;
|
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|